C13H12F3N3OS — CID 80620336
2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline (PubChem CID 80620336) has the molecular formula C13H12F3N3OS and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline.
| Compound Name | 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 80620336 |
| Molecular Formula | C13H12F3N3OS |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[3-(thiolan-2-yl)-1,2,4-oxadiazol-5-yl]-5-(trifluoromethyl)aniline |
| SMILES | Nc1cc(C(F)(F)F)ccc1-c1nc(C2CCCS2)no1 |
| InChI | InChI=1S/C13H12F3N3OS/c14-13(15,16)7-3-4-8(9(17)6-7)12-18-11(19-20-12)10-2-1-5-21-10/h3-4,6,10H,1-2,5,17H2 |
| InChIKey | YZZDLDWEMZVPGX-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|