C16H20FN3O — CID 80609851
2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-5-fluoroaniline (PubChem CID 80609851) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-5-fluoroaniline.
| Compound Name | 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-5-fluoroaniline |
|---|---|
| PubChem CID | 80609851 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-5-fluoroaniline |
| SMILES | Nc1cc(F)ccc1-c1nc(C2CCCCCCC2)no1 |
| InChI | InChI=1S/C16H20FN3O/c17-12-8-9-13(14(18)10-12)16-19-15(20-21-16)11-6-4-2-1-3-5-7-11/h8-11H,1-7,18H2 |
| InChIKey | ROKVLUVHAPLVFM-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|