C17H17N3O — CID 60921785
3-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)naphthalen-2-amine (PubChem CID 60921785) has the molecular formula C17H17N3O and a molecular weight of 279.34 g/mol. Its IUPAC name is 3-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)naphthalen-2-amine.
| Compound Name | 3-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)naphthalen-2-amine |
|---|---|
| PubChem CID | 60921785 |
| Molecular Formula | C17H17N3O |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 3-(3-cyclopentyl-1,2,4-oxadiazol-5-yl)naphthalen-2-amine |
| SMILES | Nc1cc2ccccc2cc1-c1nc(C2CCCC2)no1 |
| InChI | InChI=1S/C17H17N3O/c18-15-10-13-8-4-3-7-12(13)9-14(15)17-19-16(20-21-17)11-5-1-2-6-11/h3-4,7-11H,1-2,5-6,18H2 |
| InChIKey | MZXURGZBXZGZKD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|