C12H10N4O — CID 65418134
5-(3-aminonaphthalen-2-yl)-1,2,4-oxadiazol-3-amine (PubChem CID 65418134) has the molecular formula C12H10N4O and a molecular weight of 226.24 g/mol. Its IUPAC name is 5-(3-aminonaphthalen-2-yl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(3-aminonaphthalen-2-yl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 65418134 |
| Molecular Formula | C12H10N4O |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | 5-(3-aminonaphthalen-2-yl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(-c2cc3ccccc3cc2N)n1 |
| InChI | InChI=1S/C12H10N4O/c13-10-6-8-4-2-1-3-7(8)5-9(10)11-15-12(14)16-17-11/h1-6H,13H2,(H2,14,16) |
| InChIKey | HRBPJGRKQWTMDC-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 90.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|