C8H5BrClN3O — CID 107992789
5-(2-bromo-4-chlorophenyl)-1,2,4-oxadiazol-3-amine (PubChem CID 107992789) has the molecular formula C8H5BrClN3O and a molecular weight of 274.51 g/mol. Its IUPAC name is 5-(2-bromo-4-chlorophenyl)-1,2,4-oxadiazol-3-amine.
| Compound Name | 5-(2-bromo-4-chlorophenyl)-1,2,4-oxadiazol-3-amine |
|---|---|
| PubChem CID | 107992789 |
| Molecular Formula | C8H5BrClN3O |
| Molecular Weight | 274.51 g/mol |
| Exact Mass | 272.93 |
| IUPAC Name | 5-(2-bromo-4-chlorophenyl)-1,2,4-oxadiazol-3-amine |
| SMILES | Nc1noc(-c2ccc(Cl)cc2Br)n1 |
| InChI | InChI=1S/C8H5BrClN3O/c9-6-3-4(10)1-2-5(6)7-12-8(11)13-14-7/h1-3H,(H2,11,13) |
| InChIKey | POXRUACOWXQDKJ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.51 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |