C9H8ClN3O — CID 28529083
5-chloro-2-(3-methyl-1,2,4-oxadiazol-5-yl)aniline (PubChem CID 28529083) has the molecular formula C9H8ClN3O and a molecular weight of 209.64 g/mol. Its IUPAC name is 5-chloro-2-(3-methyl-1,2,4-oxadiazol-5-yl)aniline.
| Compound Name | 5-chloro-2-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
|---|---|
| PubChem CID | 28529083 |
| Molecular Formula | C9H8ClN3O |
| Molecular Weight | 209.64 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 5-chloro-2-(3-methyl-1,2,4-oxadiazol-5-yl)aniline |
| SMILES | Cc1noc(-c2ccc(Cl)cc2N)n1 |
| InChI | InChI=1S/C9H8ClN3O/c1-5-12-9(14-13-5)7-3-2-6(10)4-8(7)11/h2-4H,11H2,1H3 |
| InChIKey | LUIODZDMMODGEP-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.64 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|