C13H16ClN5O — CID 116807852
5-chloro-2-[3-(4-methylpiperazin-1-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 116807852) has the molecular formula C13H16ClN5O and a molecular weight of 293.76 g/mol. Its IUPAC name is 5-chloro-2-[3-(4-methylpiperazin-1-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 5-chloro-2-[3-(4-methylpiperazin-1-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 116807852 |
| Molecular Formula | C13H16ClN5O |
| Molecular Weight | 293.76 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 5-chloro-2-[3-(4-methylpiperazin-1-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CN1CCN(c2noc(-c3ccc(Cl)cc3N)n2)CC1 |
| InChI | InChI=1S/C13H16ClN5O/c1-18-4-6-19(7-5-18)13-16-12(20-17-13)10-3-2-9(14)8-11(10)15/h2-3,8H,4-7,15H2,1H3 |
| InChIKey | XHTBYUGDGLCJPG-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.76 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|