C19H28N6O — CID 146552480
3-methyl-4-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 146552480) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is 3-methyl-4-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 3-methyl-4-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 146552480 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | 3-methyl-4-[3-[4-(4-methylpiperazin-1-yl)piperidin-1-yl]-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Cc1cc(N)ccc1-c1nc(N2CCC(N3CCN(C)CC3)CC2)no1 |
| InChI | InChI=1S/C19H28N6O/c1-14-13-15(20)3-4-17(14)18-21-19(22-26-18)25-7-5-16(6-8-25)24-11-9-23(2)10-12-24/h3-4,13,16H,5-12,20H2,1-2H3 |
| InChIKey | QSFYUEGGXKCBHG-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 74.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|