C12H18ClN3 — CID 115468464
4-chloro-2-(4-methyl-1,4-diazepan-1-yl)aniline (PubChem CID 115468464) has the molecular formula C12H18ClN3 and a molecular weight of 239.75 g/mol. Its IUPAC name is 4-chloro-2-(4-methyl-1,4-diazepan-1-yl)aniline.
| Compound Name | 4-chloro-2-(4-methyl-1,4-diazepan-1-yl)aniline |
|---|---|
| PubChem CID | 115468464 |
| Molecular Formula | C12H18ClN3 |
| Molecular Weight | 239.75 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | 4-chloro-2-(4-methyl-1,4-diazepan-1-yl)aniline |
| SMILES | CN1CCCN(c2cc(Cl)ccc2N)CC1 |
| InChI | InChI=1S/C12H18ClN3/c1-15-5-2-6-16(8-7-15)12-9-10(13)3-4-11(12)14/h3-4,9H,2,5-8,14H2,1H3 |
| InChIKey | IIPJHZNKFANHAZ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.75 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|