C11H15ClN2 — CID 79688977
4-chloro-2-(3,3-dimethylazetidin-1-yl)aniline (PubChem CID 79688977) has the molecular formula C11H15ClN2 and a molecular weight of 210.71 g/mol. Its IUPAC name is 4-chloro-2-(3,3-dimethylazetidin-1-yl)aniline.
| Compound Name | 4-chloro-2-(3,3-dimethylazetidin-1-yl)aniline |
|---|---|
| PubChem CID | 79688977 |
| Molecular Formula | C11H15ClN2 |
| Molecular Weight | 210.71 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | 4-chloro-2-(3,3-dimethylazetidin-1-yl)aniline |
| SMILES | CC1(C)CN(c2cc(Cl)ccc2N)C1 |
| InChI | InChI=1S/C11H15ClN2/c1-11(2)6-14(7-11)10-5-8(12)3-4-9(10)13/h3-5H,6-7,13H2,1-2H3 |
| InChIKey | NLLLGKAPHCJVBK-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.71 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|