C17H17ClFN3 — CID 156503572
2-[6-(4-chloro-2-fluorophenyl)-2,6-diazaspiro[3.3]heptan-2-yl]aniline (PubChem CID 156503572) has the molecular formula C17H17ClFN3 and a molecular weight of 317.80 g/mol. Its IUPAC name is 2-[6-(4-chloro-2-fluorophenyl)-2,6-diazaspiro[3.3]heptan-2-yl]aniline.
| Compound Name | 2-[6-(4-chloro-2-fluorophenyl)-2,6-diazaspiro[3.3]heptan-2-yl]aniline |
|---|---|
| PubChem CID | 156503572 |
| Molecular Formula | C17H17ClFN3 |
| Molecular Weight | 317.80 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | 2-[6-(4-chloro-2-fluorophenyl)-2,6-diazaspiro[3.3]heptan-2-yl]aniline |
| SMILES | Nc1ccccc1N1CC2(C1)CN(c1ccc(Cl)cc1F)C2 |
| InChI | InChI=1S/C17H17ClFN3/c18-12-5-6-15(13(19)7-12)21-8-17(9-21)10-22(11-17)16-4-2-1-3-14(16)20/h1-7H,8-11,20H2 |
| InChIKey | PSSKKGBRKRAEMX-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.80 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|