C10H13ClN2O2 — CID 106667619
1-(2-amino-5-chlorophenyl)pyrrolidine-3,4-diol (PubChem CID 106667619) has the molecular formula C10H13ClN2O2 and a molecular weight of 228.68 g/mol. Its IUPAC name is 1-(2-amino-5-chlorophenyl)pyrrolidine-3,4-diol.
| Compound Name | 1-(2-amino-5-chlorophenyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106667619 |
| Molecular Formula | C10H13ClN2O2 |
| Molecular Weight | 228.68 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | 1-(2-amino-5-chlorophenyl)pyrrolidine-3,4-diol |
| SMILES | Nc1ccc(Cl)cc1N1CC(O)C(O)C1 |
| InChI | InChI=1S/C10H13ClN2O2/c11-6-1-2-7(12)8(3-6)13-4-9(14)10(15)5-13/h1-3,9-10,14-15H,4-5,12H2 |
| InChIKey | IDNZRZWNOMDTJF-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.68 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|