C10H12ClNO2 — CID 95562583
(3S,4R)-1-(4-chlorophenyl)pyrrolidine-3,4-diol (PubChem CID 95562583) has the molecular formula C10H12ClNO2 and a molecular weight of 213.66 g/mol. Its IUPAC name is (3S,4R)-1-(4-chlorophenyl)pyrrolidine-3,4-diol.
| Compound Name | (3S,4R)-1-(4-chlorophenyl)pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 95562583 |
| Molecular Formula | C10H12ClNO2 |
| Molecular Weight | 213.66 g/mol |
| Exact Mass | 213.06 |
| IUPAC Name | (3S,4R)-1-(4-chlorophenyl)pyrrolidine-3,4-diol |
| SMILES | O[C@@H]1CN(c2ccc(Cl)cc2)C[C@@H]1O |
| InChI | InChI=1S/C10H12ClNO2/c11-7-1-3-8(4-2-7)12-5-9(13)10(14)6-12/h1-4,9-10,13-14H,5-6H2/t9-,10+ |
| InChIKey | WGCUSUPBCDNJKP-AOOOYVTPSA-N |
| XLogP | 0.88 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.66 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |