C12H18N2O4 — CID 23103824
1-(4-aminophenyl)azepane-3,4,5,6-tetrol (PubChem CID 23103824) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 1-(4-aminophenyl)azepane-3,4,5,6-tetrol.
| Compound Name | 1-(4-aminophenyl)azepane-3,4,5,6-tetrol |
|---|---|
| PubChem CID | 23103824 |
| Molecular Formula | C12H18N2O4 |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.13 |
| IUPAC Name | 1-(4-aminophenyl)azepane-3,4,5,6-tetrol |
| SMILES | Nc1ccc(N2CC(O)C(O)C(O)C(O)C2)cc1 |
| InChI | InChI=1S/C12H18N2O4/c13-7-1-3-8(4-2-7)14-5-9(15)11(17)12(18)10(16)6-14/h1-4,9-12,15-18H,5-6,13H2 |
| InChIKey | GULUUGWQRNBOEK-UHFFFAOYSA-N |
| XLogP | -1.47 |
| TPSA | 110.18 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.29 |
| LogP ≤ 5 | -1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|