C11H15N3 — CID 84771248
4-(3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline (PubChem CID 84771248) has the molecular formula C11H15N3 and a molecular weight of 189.26 g/mol. Its IUPAC name is 4-(3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline.
| Compound Name | 4-(3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline |
|---|---|
| PubChem CID | 84771248 |
| Molecular Formula | C11H15N3 |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.13 |
| IUPAC Name | 4-(3,6-diazabicyclo[3.1.1]heptan-3-yl)aniline |
| SMILES | Nc1ccc(N2CC3CC(C2)N3)cc1 |
| InChI | InChI=1S/C11H15N3/c12-8-1-3-11(4-2-8)14-6-9-5-10(7-14)13-9/h1-4,9-10,13H,5-7,12H2 |
| InChIKey | GDHNGBMBLGBLTO-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|