C12H16N2 — CID 84770848
3-(3-methylphenyl)-3,6-diazabicyclo[3.1.1]heptane (PubChem CID 84770848) has the molecular formula C12H16N2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 3-(3-methylphenyl)-3,6-diazabicyclo[3.1.1]heptane.
| Compound Name | 3-(3-methylphenyl)-3,6-diazabicyclo[3.1.1]heptane |
|---|---|
| PubChem CID | 84770848 |
| Molecular Formula | C12H16N2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.13 |
| IUPAC Name | 3-(3-methylphenyl)-3,6-diazabicyclo[3.1.1]heptane |
| SMILES | Cc1cccc(N2CC3CC(C2)N3)c1 |
| InChI | InChI=1S/C12H16N2/c1-9-3-2-4-12(5-9)14-7-10-6-11(8-14)13-10/h2-5,10-11,13H,6-8H2,1H3 |
| InChIKey | WZSKDTZFJGCFLG-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |