C14H19NO3 — CID 13329277
(4R,8R)-4,8-dimethyl-6-(3-methylphenyl)-1,3,6-dioxazocan-2-one (PubChem CID 13329277) has the molecular formula C14H19NO3 and a molecular weight of 249.31 g/mol. Its IUPAC name is (4R,8R)-4,8-dimethyl-6-(3-methylphenyl)-1,3,6-dioxazocan-2-one.
| Compound Name | (4R,8R)-4,8-dimethyl-6-(3-methylphenyl)-1,3,6-dioxazocan-2-one |
|---|---|
| PubChem CID | 13329277 |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | (4R,8R)-4,8-dimethyl-6-(3-methylphenyl)-1,3,6-dioxazocan-2-one |
| SMILES | Cc1cccc(N2C[C@@H](C)OC(=O)O[C@H](C)C2)c1 |
| InChI | InChI=1S/C14H19NO3/c1-10-5-4-6-13(7-10)15-8-11(2)17-14(16)18-12(3)9-15/h4-7,11-12H,8-9H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | CPIXFCHNLJZVJL-VXGBXAGGSA-N |
| XLogP | 2.75 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |