C14H21NO — CID 165121156
(2R,6R)-4-(3-ethylphenyl)-2,6-dimethylmorpholine (PubChem CID 165121156) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is (2R,6R)-4-(3-ethylphenyl)-2,6-dimethylmorpholine.
| Compound Name | (2R,6R)-4-(3-ethylphenyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 165121156 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | (2R,6R)-4-(3-ethylphenyl)-2,6-dimethylmorpholine |
| SMILES | CCc1cccc(N2C[C@@H](C)O[C@H](C)C2)c1 |
| InChI | InChI=1S/C14H21NO/c1-4-13-6-5-7-14(8-13)15-9-11(2)16-12(3)10-15/h5-8,11-12H,4,9-10H2,1-3H3/t11-,12-/m1/s1 |
| InChIKey | CRIGWZZSNHBAJG-VXGBXAGGSA-N |
| XLogP | 2.86 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |