C13H19NO2 — CID 43121035
[4-(2,6-dimethylmorpholin-4-yl)phenyl]methanol (PubChem CID 43121035) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is [4-(2,6-dimethylmorpholin-4-yl)phenyl]methanol.
| Compound Name | [4-(2,6-dimethylmorpholin-4-yl)phenyl]methanol |
|---|---|
| PubChem CID | 43121035 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | [4-(2,6-dimethylmorpholin-4-yl)phenyl]methanol |
| SMILES | CC1CN(c2ccc(CO)cc2)CC(C)O1 |
| InChI | InChI=1S/C13H19NO2/c1-10-7-14(8-11(2)16-10)13-5-3-12(9-15)4-6-13/h3-6,10-11,15H,7-9H2,1-2H3 |
| InChIKey | ODIZQGWUIIOTBM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|