C13H17NO2 — CID 28603596
4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]benzaldehyde (PubChem CID 28603596) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is 4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]benzaldehyde.
| Compound Name | 4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]benzaldehyde |
|---|---|
| PubChem CID | 28603596 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | 4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]benzaldehyde |
| SMILES | C[C@@H]1CN(c2ccc(C=O)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C13H17NO2/c1-10-7-14(8-11(2)16-10)13-5-3-12(9-15)4-6-13/h3-6,9-11H,7-8H2,1-2H3/t10-,11+ |
| InChIKey | OGVXOBJOPFDWIY-PHIMTYICSA-N |
| XLogP | 2.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|