C19H31NO — CID 59545237
(2R,6S)-4-(3-heptylphenyl)-2,6-dimethylmorpholine (PubChem CID 59545237) has the molecular formula C19H31NO and a molecular weight of 289.46 g/mol. Its IUPAC name is (2R,6S)-4-(3-heptylphenyl)-2,6-dimethylmorpholine.
| Compound Name | (2R,6S)-4-(3-heptylphenyl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 59545237 |
| Molecular Formula | C19H31NO |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.24 |
| IUPAC Name | (2R,6S)-4-(3-heptylphenyl)-2,6-dimethylmorpholine |
| SMILES | CCCCCCCc1cccc(N2C[C@@H](C)O[C@@H](C)C2)c1 |
| InChI | InChI=1S/C19H31NO/c1-4-5-6-7-8-10-18-11-9-12-19(13-18)20-14-16(2)21-17(3)15-20/h9,11-13,16-17H,4-8,10,14-15H2,1-3H3/t16-,17+ |
| InChIKey | XRXQXQLKRSCRPC-CALCHBBNSA-N |
| XLogP | 4.81 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|