C13H19N3 — CID 155146967
4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)aniline (PubChem CID 155146967) has the molecular formula C13H19N3 and a molecular weight of 217.32 g/mol. Its IUPAC name is 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)aniline.
| Compound Name | 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)aniline |
|---|---|
| PubChem CID | 155146967 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 4-(8-methyl-3,8-diazabicyclo[3.2.1]octan-3-yl)aniline |
| SMILES | CN1C2CCC1CN(c1ccc(N)cc1)C2 |
| InChI | InChI=1S/C13H19N3/c1-15-12-6-7-13(15)9-16(8-12)11-4-2-10(14)3-5-11/h2-5,12-13H,6-9,14H2,1H3 |
| InChIKey | RRKDURYCRYTWMQ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|