C16H22N2 — CID 170048881
8-cyclopropyl-3-(4-methylphenyl)-3,8-diazabicyclo[3.2.1]octane (PubChem CID 170048881) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 8-cyclopropyl-3-(4-methylphenyl)-3,8-diazabicyclo[3.2.1]octane.
| Compound Name | 8-cyclopropyl-3-(4-methylphenyl)-3,8-diazabicyclo[3.2.1]octane |
|---|---|
| PubChem CID | 170048881 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 8-cyclopropyl-3-(4-methylphenyl)-3,8-diazabicyclo[3.2.1]octane |
| SMILES | Cc1ccc(N2CC3CCC(C2)N3C2CC2)cc1 |
| InChI | InChI=1S/C16H22N2/c1-12-2-4-13(5-3-12)17-10-15-8-9-16(11-17)18(15)14-6-7-14/h2-5,14-16H,6-11H2,1H3 |
| InChIKey | QYVNNRNPEZLNOK-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|