C14H19F2N3 — CID 138515875
4-[(5S)-8,8-difluoro-6-methyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]aniline (PubChem CID 138515875) has the molecular formula C14H19F2N3 and a molecular weight of 267.32 g/mol. Its IUPAC name is 4-[(5S)-8,8-difluoro-6-methyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]aniline.
| Compound Name | 4-[(5S)-8,8-difluoro-6-methyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]aniline |
|---|---|
| PubChem CID | 138515875 |
| Molecular Formula | C14H19F2N3 |
| Molecular Weight | 267.32 g/mol |
| Exact Mass | 267.15 |
| IUPAC Name | 4-[(5S)-8,8-difluoro-6-methyl-3,6-diazabicyclo[3.2.2]nonan-3-yl]aniline |
| SMILES | CN1CC2CN(c3ccc(N)cc3)C[C@@H]1CC2(F)F |
| InChI | InChI=1S/C14H19F2N3/c1-18-7-10-8-19(9-13(18)6-14(10,15)16)12-4-2-11(17)3-5-12/h2-5,10,13H,6-9,17H2,1H3/t10?,13-/m0/s1 |
| InChIKey | LUSAGYYABJLLAG-HQVZTVAUSA-N |
| XLogP | 2.04 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|