About 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline
4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline (PubChem CID 170049377) has the molecular formula C16H25N3O
and a molecular weight of 275.40 g/mol. Its IUPAC name is 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline.
Molecular Properties
| Compound Name | 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline |
| PubChem CID | 170049377 |
| Molecular Formula | C16H25N3O |
| Molecular Weight | 275.40 g/mol |
| Exact Mass | 275.20 |
| IUPAC Name | 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline |
| SMILES | COCCN1CC2CC(C1)CN(c1ccc(N)cc1)C2 |
| InChI | InChI=1S/C16H25N3O/c1-20-7-6-18-9-13-8-14(10-18)12-19(11-13)16-4-2-15(17)3-5-16/h2-5,13-14H,6-12,17H2,1H3 |
| InChIKey | SIIDRQKFMLYVLO-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 41.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.40 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline?
The IUPAC name of 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline (CID 170049377) is 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline.
What is the SMILES notation for 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline?
The canonical SMILES for 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline is COCCN1CC2CC(C1)CN(c1ccc(N)cc1)C2.
What is the InChIKey of 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline?
The InChIKey is SIIDRQKFMLYVLO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H25N3O/c1-20-7-6-18-9-13-8-14(10-18)12-19(11-13)16-4-2-15(17)3-5-16/h2-5,13-14H,6-12,17H2,1H3.
What are the key properties of 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline?
4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline has a molecular weight of 275.40 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[7-(2-methoxyethyl)-3,7-diazabicyclo[3.3.1]nonan-3-yl]aniline is sourced from PubChem (CID 170049377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).