C15H23ClN2O2 — CID 106670521
1-[2-[(tert-butylamino)methyl]-5-chlorophenyl]pyrrolidine-3,4-diol (PubChem CID 106670521) has the molecular formula C15H23ClN2O2 and a molecular weight of 298.81 g/mol. Its IUPAC name is 1-[2-[(tert-butylamino)methyl]-5-chlorophenyl]pyrrolidine-3,4-diol.
| Compound Name | 1-[2-[(tert-butylamino)methyl]-5-chlorophenyl]pyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 106670521 |
| Molecular Formula | C15H23ClN2O2 |
| Molecular Weight | 298.81 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-[2-[(tert-butylamino)methyl]-5-chlorophenyl]pyrrolidine-3,4-diol |
| SMILES | CC(C)(C)NCc1ccc(Cl)cc1N1CC(O)C(O)C1 |
| InChI | InChI=1S/C15H23ClN2O2/c1-15(2,3)17-7-10-4-5-11(16)6-12(10)18-8-13(19)14(20)9-18/h4-6,13-14,17,19-20H,7-9H2,1-3H3 |
| InChIKey | CEGNNHQGNSRWAB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.81 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |