C8H3Cl2FN2O — CID 112572126
3-chloro-5-(4-chloro-2-fluorophenyl)-1,2,4-oxadiazole (PubChem CID 112572126) has the molecular formula C8H3Cl2FN2O and a molecular weight of 233.03 g/mol. Its IUPAC name is 3-chloro-5-(4-chloro-2-fluorophenyl)-1,2,4-oxadiazole.
| Compound Name | 3-chloro-5-(4-chloro-2-fluorophenyl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 112572126 |
| Molecular Formula | C8H3Cl2FN2O |
| Molecular Weight | 233.03 g/mol |
| Exact Mass | 231.96 |
| IUPAC Name | 3-chloro-5-(4-chloro-2-fluorophenyl)-1,2,4-oxadiazole |
| SMILES | Fc1cc(Cl)ccc1-c1nc(Cl)no1 |
| InChI | InChI=1S/C8H3Cl2FN2O/c9-4-1-2-5(6(11)3-4)7-12-8(10)13-14-7/h1-3H |
| InChIKey | SLDDSJARWOBMER-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.03 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |