C15H17FN2O2 — CID 136789933
2-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol (PubChem CID 136789933) has the molecular formula C15H17FN2O2 and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol.
| Compound Name | 2-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol |
|---|---|
| PubChem CID | 136789933 |
| Molecular Formula | C15H17FN2O2 |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 2-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol |
| SMILES | Oc1cc(F)ccc1-c1nc(C2CCCCCC2)no1 |
| InChI | InChI=1S/C15H17FN2O2/c16-11-7-8-12(13(19)9-11)15-17-14(18-20-15)10-5-3-1-2-4-6-10/h7-10,19H,1-6H2 |
| InChIKey | LFFBVAGIYCZMGT-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |