C16H20N2O3 — CID 136813508
2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol (PubChem CID 136813508) has the molecular formula C16H20N2O3 and a molecular weight of 288.35 g/mol. Its IUPAC name is 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol.
| Compound Name | 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 136813508 |
| Molecular Formula | C16H20N2O3 |
| Molecular Weight | 288.35 g/mol |
| Exact Mass | 288.15 |
| IUPAC Name | 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1-c1nc(C2CCCCCCC2)no1 |
| InChI | InChI=1S/C16H20N2O3/c19-12-9-6-10-13(20)14(12)16-17-15(18-21-16)11-7-4-2-1-3-5-8-11/h6,9-11,19-20H,1-5,7-8H2 |
| InChIKey | GBSZFZQKAYAHOT-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.35 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |