C16H19FN2O2 — CID 136789963
2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol (PubChem CID 136789963) has the molecular formula C16H19FN2O2 and a molecular weight of 290.34 g/mol. Its IUPAC name is 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol.
| Compound Name | 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol |
|---|---|
| PubChem CID | 136789963 |
| Molecular Formula | C16H19FN2O2 |
| Molecular Weight | 290.34 g/mol |
| Exact Mass | 290.14 |
| IUPAC Name | 2-(3-cyclooctyl-1,2,4-oxadiazol-5-yl)-5-fluorophenol |
| SMILES | Oc1cc(F)ccc1-c1nc(C2CCCCCCC2)no1 |
| InChI | InChI=1S/C16H19FN2O2/c17-12-8-9-13(14(20)10-12)16-18-15(19-21-16)11-6-4-2-1-3-5-7-11/h8-11,20H,1-7H2 |
| InChIKey | HQXSKYQOAJKUBI-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 59.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.34 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |