C15H18N2O3 — CID 136813482
2-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol (PubChem CID 136813482) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 2-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol.
| Compound Name | 2-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol |
|---|---|
| PubChem CID | 136813482 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 2-(3-cycloheptyl-1,2,4-oxadiazol-5-yl)benzene-1,3-diol |
| SMILES | Oc1cccc(O)c1-c1nc(C2CCCCCC2)no1 |
| InChI | InChI=1S/C15H18N2O3/c18-11-8-5-9-12(19)13(11)15-16-14(17-20-15)10-6-3-1-2-4-7-10/h5,8-10,18-19H,1-4,6-7H2 |
| InChIKey | YOZLHXXLDMYXBI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |