C12H12BrN3OS2 — CID 107813781
2-bromo-5-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 107813781) has the molecular formula C12H12BrN3OS2 and a molecular weight of 358.29 g/mol. Its IUPAC name is 2-bromo-5-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 2-bromo-5-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 107813781 |
| Molecular Formula | C12H12BrN3OS2 |
| Molecular Weight | 358.29 g/mol |
| Exact Mass | 356.96 |
| IUPAC Name | 2-bromo-5-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1cc(-c2nc(C3CSCCS3)no2)ccc1Br |
| InChI | InChI=1S/C12H12BrN3OS2/c13-8-2-1-7(5-9(8)14)12-15-11(16-17-12)10-6-18-3-4-19-10/h1-2,5,10H,3-4,6,14H2 |
| InChIKey | DRFKSLDAEMWBLX-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.29 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|