C11H11N3O2S2 — CID 79965429
5-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol (PubChem CID 79965429) has the molecular formula C11H11N3O2S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 5-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol.
| Compound Name | 5-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol |
|---|---|
| PubChem CID | 79965429 |
| Molecular Formula | C11H11N3O2S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 5-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]pyridin-3-ol |
| SMILES | Oc1cncc(-c2nc(C3CSCCS3)no2)c1 |
| InChI | InChI=1S/C11H11N3O2S2/c15-8-3-7(4-12-5-8)11-13-10(14-16-11)9-6-17-1-2-18-9/h3-5,9,15H,1-2,6H2 |
| InChIKey | HXUUGVMRZZFBQB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 72.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |