About 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole
3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole (PubChem CID 100689851) has the molecular formula C11H16N2O2S2
and a molecular weight of 272.40 g/mol. Its IUPAC name is 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole.
Molecular Properties
| Compound Name | 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole |
| PubChem CID | 100689851 |
| Molecular Formula | C11H16N2O2S2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole |
| SMILES | C1CC(c2nc([C@@H]3CSCCS3)no2)CCO1 |
| InChI | InChI=1S/C11H16N2O2S2/c1-3-14-4-2-8(1)11-12-10(13-15-11)9-7-16-5-6-17-9/h8-9H,1-7H2/t9-/m0/s1 |
| InChIKey | ACKQHINKGDFFJF-VIFPVBQESA-N |
| XLogP | 2.48 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole?
The IUPAC name of 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole (CID 100689851) is 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole.
What is the SMILES notation for 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole?
The canonical SMILES for 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole is C1CC(c2nc([C@@H]3CSCCS3)no2)CCO1.
What is the InChIKey of 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole?
The InChIKey is ACKQHINKGDFFJF-VIFPVBQESA-N. The full InChI is InChI=1S/C11H16N2O2S2/c1-3-14-4-2-8(1)11-12-10(13-15-11)9-7-16-5-6-17-9/h8-9H,1-7H2/t9-/m0/s1.
What are the key properties of 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole?
3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole has a molecular weight of 272.40 g/mol, XLogP of 2.48, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole is sourced from PubChem (CID 100689851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).