C11H16N2O2S2 — CID 100689851
3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole (PubChem CID 100689851) has the molecular formula C11H16N2O2S2 and a molecular weight of 272.40 g/mol. Its IUPAC name is 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole.
| Compound Name | 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 100689851 |
| Molecular Formula | C11H16N2O2S2 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 3-[(2R)-1,4-dithian-2-yl]-5-(oxan-4-yl)-1,2,4-oxadiazole |
| SMILES | C1CC(c2nc([C@@H]3CSCCS3)no2)CCO1 |
| InChI | InChI=1S/C11H16N2O2S2/c1-3-14-4-2-8(1)11-12-10(13-15-11)9-7-16-5-6-17-9/h8-9H,1-7H2/t9-/m0/s1 |
| InChIKey | ACKQHINKGDFFJF-VIFPVBQESA-N |
| XLogP | 2.48 |
| TPSA | 48.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |