C15H17N3OS2 — CID 104915398
3-(1,4-dithian-2-yl)-5-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]-1,2,4-oxadiazole (PubChem CID 104915398) has the molecular formula C15H17N3OS2 and a molecular weight of 319.46 g/mol. Its IUPAC name is 3-(1,4-dithian-2-yl)-5-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]-1,2,4-oxadiazole.
| Compound Name | 3-(1,4-dithian-2-yl)-5-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 104915398 |
| Molecular Formula | C15H17N3OS2 |
| Molecular Weight | 319.46 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 3-(1,4-dithian-2-yl)-5-[(3R)-1,2,3,4-tetrahydroisoquinolin-3-yl]-1,2,4-oxadiazole |
| SMILES | c1ccc2c(c1)CN[C@@H](c1nc(C3CSCCS3)no1)C2 |
| InChI | InChI=1S/C15H17N3OS2/c1-2-4-11-8-16-12(7-10(11)3-1)15-17-14(18-19-15)13-9-20-5-6-21-13/h1-4,12-13,16H,5-9H2/t12-,13?/m1/s1 |
| InChIKey | RCLSXWRJMJSIAN-PZORYLMUSA-N |
| XLogP | 2.98 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.46 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |