C12H12FN3OS2 — CID 79971455
2-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-fluoroaniline (PubChem CID 79971455) has the molecular formula C12H12FN3OS2 and a molecular weight of 297.38 g/mol. Its IUPAC name is 2-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-fluoroaniline.
| Compound Name | 2-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-fluoroaniline |
|---|---|
| PubChem CID | 79971455 |
| Molecular Formula | C12H12FN3OS2 |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.04 |
| IUPAC Name | 2-[3-(1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-4-fluoroaniline |
| SMILES | Nc1ccc(F)cc1-c1nc(C2CSCCS2)no1 |
| InChI | InChI=1S/C12H12FN3OS2/c13-7-1-2-9(14)8(5-7)12-15-11(16-17-12)10-6-18-3-4-19-10/h1-2,5,10H,3-4,6,14H2 |
| InChIKey | PVRQXKINBJLNHI-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|