C14H16N2O3S2 — CID 136904556
4-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,2-diol (PubChem CID 136904556) has the molecular formula C14H16N2O3S2 and a molecular weight of 324.43 g/mol. Its IUPAC name is 4-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,2-diol.
| Compound Name | 4-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,2-diol |
|---|---|
| PubChem CID | 136904556 |
| Molecular Formula | C14H16N2O3S2 |
| Molecular Weight | 324.43 g/mol |
| Exact Mass | 324.06 |
| IUPAC Name | 4-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]benzene-1,2-diol |
| SMILES | CC1SCC(c2noc(-c3ccc(O)c(O)c3)n2)SC1C |
| InChI | InChI=1S/C14H16N2O3S2/c1-7-8(2)21-12(6-20-7)13-15-14(19-16-13)9-3-4-10(17)11(18)5-9/h3-5,7-8,12,17-18H,6H2,1-2H3 |
| InChIKey | SQSKLPOIDAJPTM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.43 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|