C14H16BrN3OS2 — CID 103344433
5-bromo-2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 103344433) has the molecular formula C14H16BrN3OS2 and a molecular weight of 386.34 g/mol. Its IUPAC name is 5-bromo-2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 5-bromo-2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 103344433 |
| Molecular Formula | C14H16BrN3OS2 |
| Molecular Weight | 386.34 g/mol |
| Exact Mass | 384.99 |
| IUPAC Name | 5-bromo-2-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | CC1SCC(c2noc(-c3ccc(Br)cc3N)n2)SC1C |
| InChI | InChI=1S/C14H16BrN3OS2/c1-7-8(2)21-12(6-20-7)13-17-14(19-18-13)10-4-3-9(15)5-11(10)16/h3-5,7-8,12H,6,16H2,1-2H3 |
| InChIKey | ADCSNZXKXIKSFZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.34 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|