C10H14N6OS2 — CID 103344457
5-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine (PubChem CID 103344457) has the molecular formula C10H14N6OS2 and a molecular weight of 298.40 g/mol. Its IUPAC name is 5-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine.
| Compound Name | 5-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 103344457 |
| Molecular Formula | C10H14N6OS2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 5-[3-(5,6-dimethyl-1,4-dithian-2-yl)-1,2,4-oxadiazol-5-yl]-1H-1,2,4-triazol-3-amine |
| SMILES | CC1SCC(c2noc(-c3nc(N)n[nH]3)n2)SC1C |
| InChI | InChI=1S/C10H14N6OS2/c1-4-5(2)19-6(3-18-4)7-12-9(17-16-7)8-13-10(11)15-14-8/h4-6H,3H2,1-2H3,(H3,11,13,14,15) |
| InChIKey | MPJOLOAQQJCSHF-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 106.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |