C12H12BrN3O3 — CID 65353742
5-bromo-2-[3-(1,4-dioxan-2-yl)-1,2,4-oxadiazol-5-yl]aniline (PubChem CID 65353742) has the molecular formula C12H12BrN3O3 and a molecular weight of 326.15 g/mol. Its IUPAC name is 5-bromo-2-[3-(1,4-dioxan-2-yl)-1,2,4-oxadiazol-5-yl]aniline.
| Compound Name | 5-bromo-2-[3-(1,4-dioxan-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
|---|---|
| PubChem CID | 65353742 |
| Molecular Formula | C12H12BrN3O3 |
| Molecular Weight | 326.15 g/mol |
| Exact Mass | 325.01 |
| IUPAC Name | 5-bromo-2-[3-(1,4-dioxan-2-yl)-1,2,4-oxadiazol-5-yl]aniline |
| SMILES | Nc1cc(Br)ccc1-c1nc(C2COCCO2)no1 |
| InChI | InChI=1S/C12H12BrN3O3/c13-7-1-2-8(9(14)5-7)12-15-11(16-19-12)10-6-17-3-4-18-10/h1-2,5,10H,3-4,6,14H2 |
| InChIKey | SOAVRZYENQDRCI-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 83.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.15 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|