C14H12ClN3O2 — CID 136767992
5-(3-chloro-1H-indol-2-yl)-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole (PubChem CID 136767992) has the molecular formula C14H12ClN3O2 and a molecular weight of 289.72 g/mol. Its IUPAC name is 5-(3-chloro-1H-indol-2-yl)-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-(3-chloro-1H-indol-2-yl)-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 136767992 |
| Molecular Formula | C14H12ClN3O2 |
| Molecular Weight | 289.72 g/mol |
| Exact Mass | 289.06 |
| IUPAC Name | 5-(3-chloro-1H-indol-2-yl)-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole |
| SMILES | Clc1c(-c2nc([C@@H]3CCOC3)no2)[nH]c2ccccc12 |
| InChI | InChI=1S/C14H12ClN3O2/c15-11-9-3-1-2-4-10(9)16-12(11)14-17-13(18-20-14)8-5-6-19-7-8/h1-4,8,16H,5-7H2/t8-/m1/s1 |
| InChIKey | GRMVNGBTNBEZSN-MRVPVSSYSA-N |
| XLogP | 3.38 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.72 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |