C15H13N3O2 — CID 97433577
5-isoquinolin-1-yl-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole (PubChem CID 97433577) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 5-isoquinolin-1-yl-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-isoquinolin-1-yl-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 97433577 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-isoquinolin-1-yl-3-[(3S)-oxolan-3-yl]-1,2,4-oxadiazole |
| SMILES | c1ccc2c(-c3nc([C@@H]4CCOC4)no3)nccc2c1 |
| InChI | InChI=1S/C15H13N3O2/c1-2-4-12-10(3-1)5-7-16-13(12)15-17-14(18-20-15)11-6-8-19-9-11/h1-5,7,11H,6,8-9H2/t11-/m1/s1 |
| InChIKey | OHNHQMSVYLMOMM-LLVKDONJSA-N |
| XLogP | 2.79 |
| TPSA | 61.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |