C15H15N3O2 — CID 136903584
5-(3-methyl-1H-indol-2-yl)-3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazole (PubChem CID 136903584) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 5-(3-methyl-1H-indol-2-yl)-3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazole.
| Compound Name | 5-(3-methyl-1H-indol-2-yl)-3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 136903584 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 5-(3-methyl-1H-indol-2-yl)-3-[(3R)-oxolan-3-yl]-1,2,4-oxadiazole |
| SMILES | Cc1c(-c2nc([C@H]3CCOC3)no2)[nH]c2ccccc12 |
| InChI | InChI=1S/C15H15N3O2/c1-9-11-4-2-3-5-12(11)16-13(9)15-17-14(18-20-15)10-6-7-19-8-10/h2-5,10,16H,6-8H2,1H3/t10-/m0/s1 |
| InChIKey | DAAWHVCZISYFNS-JTQLQIEISA-N |
| XLogP | 3.03 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|