C16H20N2O2S — CID 62539832
4-(2,5-dimethoxyphenyl)-2-piperidin-3-yl-1,3-thiazole (PubChem CID 62539832) has the molecular formula C16H20N2O2S and a molecular weight of 304.42 g/mol. Its IUPAC name is 4-(2,5-dimethoxyphenyl)-2-piperidin-3-yl-1,3-thiazole.
| Compound Name | 4-(2,5-dimethoxyphenyl)-2-piperidin-3-yl-1,3-thiazole |
|---|---|
| PubChem CID | 62539832 |
| Molecular Formula | C16H20N2O2S |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 4-(2,5-dimethoxyphenyl)-2-piperidin-3-yl-1,3-thiazole |
| SMILES | COc1ccc(OC)c(-c2csc(C3CCCNC3)n2)c1 |
| InChI | InChI=1S/C16H20N2O2S/c1-19-12-5-6-15(20-2)13(8-12)14-10-21-16(18-14)11-4-3-7-17-9-11/h5-6,8,10-11,17H,3-4,7,9H2,1-2H3 |
| InChIKey | JTWOEPIUJXKJIR-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |