C17H22N2S — CID 62795975
2-piperidin-3-yl-4-(2,4,5-trimethylphenyl)-1,3-thiazole (PubChem CID 62795975) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 2-piperidin-3-yl-4-(2,4,5-trimethylphenyl)-1,3-thiazole.
| Compound Name | 2-piperidin-3-yl-4-(2,4,5-trimethylphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 62795975 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-piperidin-3-yl-4-(2,4,5-trimethylphenyl)-1,3-thiazole |
| SMILES | Cc1cc(C)c(-c2csc(C3CCCNC3)n2)cc1C |
| InChI | InChI=1S/C17H22N2S/c1-11-7-13(3)15(8-12(11)2)16-10-20-17(19-16)14-5-4-6-18-9-14/h7-8,10,14,18H,4-6,9H2,1-3H3 |
| InChIKey | AXHVZHGTDCKVNO-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |