C8H12N2S — CID 93492448
4-methyl-2-[(3R)-pyrrolidin-3-yl]-1,3-thiazole (PubChem CID 93492448) has the molecular formula C8H12N2S and a molecular weight of 168.26 g/mol. Its IUPAC name is 4-methyl-2-[(3R)-pyrrolidin-3-yl]-1,3-thiazole.
| Compound Name | 4-methyl-2-[(3R)-pyrrolidin-3-yl]-1,3-thiazole |
|---|---|
| PubChem CID | 93492448 |
| Molecular Formula | C8H12N2S |
| Molecular Weight | 168.26 g/mol |
| Exact Mass | 168.07 |
| IUPAC Name | 4-methyl-2-[(3R)-pyrrolidin-3-yl]-1,3-thiazole |
| SMILES | Cc1csc([C@@H]2CCNC2)n1 |
| InChI | InChI=1S/C8H12N2S/c1-6-5-11-8(10-6)7-2-3-9-4-7/h5,7,9H,2-4H2,1H3/t7-/m1/s1 |
| InChIKey | ACPQVAZLVXNZMH-SSDOTTSWSA-N |
| XLogP | 1.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.26 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |