About 2,4-di(pyrrolidin-3-yl)-1,3-thiazole
2,4-di(pyrrolidin-3-yl)-1,3-thiazole (PubChem CID 115034162) has the molecular formula C11H17N3S
and a molecular weight of 223.34 g/mol. Its IUPAC name is 2,4-di(pyrrolidin-3-yl)-1,3-thiazole.
Molecular Properties
| Compound Name | 2,4-di(pyrrolidin-3-yl)-1,3-thiazole |
| PubChem CID | 115034162 |
| Molecular Formula | C11H17N3S |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.11 |
| IUPAC Name | 2,4-di(pyrrolidin-3-yl)-1,3-thiazole |
| SMILES | c1sc(C2CCNC2)nc1C1CCNC1 |
| InChI | InChI=1S/C11H17N3S/c1-3-12-5-8(1)10-7-15-11(14-10)9-2-4-13-6-9/h7-9,12-13H,1-6H2 |
| InChIKey | DATHFVDRGWFVDR-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 36.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-di(pyrrolidin-3-yl)-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-di(pyrrolidin-3-yl)-1,3-thiazole?
The IUPAC name of 2,4-di(pyrrolidin-3-yl)-1,3-thiazole (CID 115034162) is 2,4-di(pyrrolidin-3-yl)-1,3-thiazole.
What is the SMILES notation for 2,4-di(pyrrolidin-3-yl)-1,3-thiazole?
The canonical SMILES for 2,4-di(pyrrolidin-3-yl)-1,3-thiazole is c1sc(C2CCNC2)nc1C1CCNC1.
What is the InChIKey of 2,4-di(pyrrolidin-3-yl)-1,3-thiazole?
The InChIKey is DATHFVDRGWFVDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17N3S/c1-3-12-5-8(1)10-7-15-11(14-10)9-2-4-13-6-9/h7-9,12-13H,1-6H2.
What are the key properties of 2,4-di(pyrrolidin-3-yl)-1,3-thiazole?
2,4-di(pyrrolidin-3-yl)-1,3-thiazole has a molecular weight of 223.34 g/mol, XLogP of 1.30, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-di(pyrrolidin-3-yl)-1,3-thiazole is sourced from PubChem (CID 115034162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).