C14H23ClN2S — CID 120558204
4-cyclohexyl-2-piperidin-4-yl-1,3-thiazole;hydrochloride (PubChem CID 120558204) has the molecular formula C14H23ClN2S and a molecular weight of 286.87 g/mol. Its IUPAC name is 4-cyclohexyl-2-piperidin-4-yl-1,3-thiazole;hydrochloride.
| Compound Name | 4-cyclohexyl-2-piperidin-4-yl-1,3-thiazole;hydrochloride |
|---|---|
| PubChem CID | 120558204 |
| Molecular Formula | C14H23ClN2S |
| Molecular Weight | 286.87 g/mol |
| Exact Mass | 286.13 |
| IUPAC Name | 4-cyclohexyl-2-piperidin-4-yl-1,3-thiazole;hydrochloride |
| SMILES | Cl.c1sc(C2CCNCC2)nc1C1CCCCC1 |
| InChI | InChI=1S/C14H22N2S.ClH/c1-2-4-11(5-3-1)13-10-17-14(16-13)12-6-8-15-9-7-12;/h10-12,15H,1-9H2;1H |
| InChIKey | HEQIETWMDNBTQJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.87 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |