C13H20N2OS — CID 116890353
2-(2-cyclohexyl-1,3-thiazol-4-yl)morpholine (PubChem CID 116890353) has the molecular formula C13H20N2OS and a molecular weight of 252.38 g/mol. Its IUPAC name is 2-(2-cyclohexyl-1,3-thiazol-4-yl)morpholine.
| Compound Name | 2-(2-cyclohexyl-1,3-thiazol-4-yl)morpholine |
|---|---|
| PubChem CID | 116890353 |
| Molecular Formula | C13H20N2OS |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.13 |
| IUPAC Name | 2-(2-cyclohexyl-1,3-thiazol-4-yl)morpholine |
| SMILES | c1sc(C2CCCCC2)nc1C1CNCCO1 |
| InChI | InChI=1S/C13H20N2OS/c1-2-4-10(5-3-1)13-15-11(9-17-13)12-8-14-6-7-16-12/h9-10,12,14H,1-8H2 |
| InChIKey | SBJZEUDTBZDFJV-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |