C14H23N3O2 — CID 103972025
2-(5-cyclooctyl-1,2,4-oxadiazol-3-yl)morpholine (PubChem CID 103972025) has the molecular formula C14H23N3O2 and a molecular weight of 265.36 g/mol. Its IUPAC name is 2-(5-cyclooctyl-1,2,4-oxadiazol-3-yl)morpholine.
| Compound Name | 2-(5-cyclooctyl-1,2,4-oxadiazol-3-yl)morpholine |
|---|---|
| PubChem CID | 103972025 |
| Molecular Formula | C14H23N3O2 |
| Molecular Weight | 265.36 g/mol |
| Exact Mass | 265.18 |
| IUPAC Name | 2-(5-cyclooctyl-1,2,4-oxadiazol-3-yl)morpholine |
| SMILES | C1CCCC(c2nc(C3CNCCO3)no2)CCC1 |
| InChI | InChI=1S/C14H23N3O2/c1-2-4-6-11(7-5-3-1)14-16-13(17-19-14)12-10-15-8-9-18-12/h11-12,15H,1-10H2 |
| InChIKey | LZOTVRDVHPYFCR-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.36 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |